|
|
| | cirsimarin Basic information |
| Product Name: | cirsimarin | | Synonyms: | cirsimarin;4H-1-Benzopyran-4-one,2-[4-(b-D-glucopyranosyloxy)phenyl]-5-hydroxy-6,7-dimethoxy-;2-[4-(beta-D-Glucopyranosyloxy)phenyl]-5-hydroxy-6,7-dimethoxy-4H-1-benzopyran-4-one;4H-1-Benzopyran-4-one, 2-[4-(β-D-glucopyranosyloxy)phenyl]-5-hydroxy-6,7-dimethoxy-;Cirsimarine;Cirsimarin, 10 mM in DMSO | | CAS: | 13020-19-4 | | MF: | C23H24O11 | | MW: | 476.43 | | EINECS: | | | Product Categories: | | | Mol File: | 13020-19-4.mol |  |
| | cirsimarin Chemical Properties |
| Melting point | 244-246℃ | | Boiling point | 767.1±60.0 °C(Predicted) | | density | 1.523 | | storage temp. | -20°C | | form | Solid | | pka | 6.33±0.40(Predicted) | | color | Off-white to light yellow | | biological source | plant | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChIKey | RETJLKUBHXTIGH-FZFRBNDOSA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)Oc2ccc(cc2)c3[o]c4c([c](c3)=O)c(c(c(c4)OC)OC)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | cirsimarin Usage And Synthesis |
| Uses | Cirsimarin is a natural product derived from plant source th at finds application in compound screening libraries, metabolomics, phytochemical, and pharmaceutical research. | | Definition | ChEBI: Cirsimarin is a glycoside and a member of flavonoids. | | Biological Activity | Cirsimarin exerts potent antilipogenic effect and decreases adipose tissue deposition in mice. Cirsimarin could therefore be a potential candidate for the treatment of obesity. |
| | cirsimarin Preparation Products And Raw materials |
|