|
|
| | 3-methacrylamidophenylboronic acid Basic information |
| Product Name: | 3-methacrylamidophenylboronic acid | | Synonyms: | 3-methacrylamidophenylboronic acid;Boronic acid, [3-[(2-Methyl-1-oxo-2-propenyl)aMino]phenyl]-;[3-[(2-Methyl-1-oxo-2-propenyl)amino]phenyl]boronic acid;3-Methacrylamidophenylboronic Acid (contains varying amounts of Anhydride);3-methacryL;Boronic acid, B-[3-[(2-methyl-1-oxo-2-propen-1-yl)amino]phenyl]-;3-Methacrylamidobenzeneboronic Acid;{3-[(2-methylacryloyl)amino]phenyl}boronic acid | | CAS: | 48150-45-4 | | MF: | C10H12BNO3 | | MW: | 205.02 | | EINECS: | | | Product Categories: | blocks;BoronicAcids | | Mol File: | 48150-45-4.mol |  |
| | 3-methacrylamidophenylboronic acid Chemical Properties |
| density | 1.18±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 7.99±0.10(Predicted) | | form | powder to crystal | | color | White to Light yellow | | InChI | 1S/C10H12BNO3/c1-7(2)10(13)12-9-5-3-4-8(6-9)11(14)15/h3-6,14-15H,1H2,2H3,(H,12,13) | | InChIKey | GBBUBIKYAQLESK-UHFFFAOYSA-N | | SMILES | CC(C(NC1=CC=CC(B(O)O)=C1)=O)=C |
| WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | 3-methacrylamidophenylboronic acid Usage And Synthesis |
| | 3-methacrylamidophenylboronic acid Preparation Products And Raw materials |
|