| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Shikimate-3-phosphate Basic information |
| Product Name: | Shikimate-3-phosphate | | Synonyms: | S-3-P;(3R,4S,5R)-;ShikiMate-3-phosphate
DISCONTINUED. See S357026;shikimic acid-3-phosphate;(-)-Phosphoric acid [(1R)-3-(carboxylato)-5β,6α-dihydroxy-2-cyclohexene-1α-yl] ester;Phosphoric acid [(3R)-4β,5α-dihydroxy-1-carboxylato-1-cyclohexene-3β-yl] ester;1-Cyclohexene-1-carboxylic acid, 4,5-dihydroxy-3-(phosphonooxy)-, (3R,4S,5R)-;(3R,4S,5R)-4,5-dihydroxy-3-phosphonooxycyclohexene-1-carboxylicaci | | CAS: | 63959-45-5 | | MF: | C7H11O8P | | MW: | 254.13 | | EINECS: | | | Product Categories: | Metabolites;Various Metabolites and Impurities;Phosphorylating and Phosphitylating Agents;Chiral Reagents | | Mol File: | 63959-45-5.mol |  |
| | Shikimate-3-phosphate Chemical Properties |
| Boiling point | 585.8±60.0 °C(Predicted) | | density | 1.84±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, Under Inert Atmosphere | | solubility | Water | | form | solid | | pka | 1.85±0.10(Predicted) | | color | White | | Stability: | Very Hygroscopic, Moisture Sensitive, Store under Argon and in Freezer | | Major Application | clinical testing | | InChI | 1S/C7H11O8P/c8-4-1-3(7(10)11)2-5(6(4)9)15-16(12,13)14/h2,4-6,8-9H,1H2,(H,10,11)(H2,12,13,14)/t4-,5-,6+/m1/s1 | | InChIKey | QYOJSKGCWNAKGW-PBXRRBTRSA-N | | SMILES | OC(C1=C[C@@H](OP(O)(O)=O)[C@@H](O)[C@H](O)C1)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Shikimate-3-phosphate Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | S-3-p is the substrate for 5-Enolpyruvoyl-shikimate 3-phosphate synthase (EPSPS) which is the target for the broad-spectrum herbicide N-(phosphonomethyl)glycine(glyphosate). | | Definition | ChEBI: 3-phosphoshikimic acid is a phosphoshikimic acid. It has a role as an Escherichia coli metabolite. It is functionally related to a shikimic acid. It is a conjugate acid of a 3-phosphonatoshikimate(3-). | | Biological Activity | Substrate of the pivotal EPSP synthase in the shikimate - chorismic acid pathway of most plants and many microorganisms. |
| | Shikimate-3-phosphate Preparation Products And Raw materials |
|