| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (R)-(+)-2,2'-DIMETHOXY-1,1'-BINAPHTHYL Basic information |
| Product Name: | (R)-(+)-2,2'-DIMETHOXY-1,1'-BINAPHTHYL | | Synonyms: | NSC 244962;NSC 37210;2,2'-Dimethoxy-1,1'-binaphthalene 97%;(S)-(-)-2,2'-DIMETHOXY-1,1'-BINAPHTHYL;(S)-(+)-2,2'-DIMETHOXY-1,1'-BINAPHTHYL;(S)-2,2'-DIMETHOXY-1,1'-BINAPHTHYL;(R)-(+)-1,1'-BI-2-NAPHTHOL DIMETHYL ETHER;(R)-(+)-2,2'-DIMETHOXY-1,1'-BI-NAPHTHOL | | CAS: | 2960-93-2 | | MF: | C22H18O2 | | MW: | 314.38 | | EINECS: | | | Product Categories: | | | Mol File: | 2960-93-2.mol |  |
| | (R)-(+)-2,2'-DIMETHOXY-1,1'-BINAPHTHYL Chemical Properties |
| Melting point | 227-231 °C(lit.) | | Boiling point | 414.05°C (rough estimate) | | density | 1.160 | | refractive index | 1.5100 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder | | color | White to beige | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C22H18O2/c1-23-19-13-11-15-7-3-5-9-17(15)21(19)22-18-10-6-4-8-16(18)12-14-20(22)24-2/h3-14H,1-2H3 | | InChIKey | BJAADAKPADTRCH-UHFFFAOYSA-N | | SMILES | C1(C2=C3C(C=CC=C3)=CC=C2OC)=C2C(C=CC=C2)=CC=C1OC |
| Hazard Codes | Xi,N | | Risk Statements | 41-50/53-37/38 | | Safety Statements | 26-36/39-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | HazardClass | 9 | | HS Code | 29093090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | (R)-(+)-2,2'-DIMETHOXY-1,1'-BINAPHTHYL Usage And Synthesis |
| Chemical Properties | white to beige crystalline powder | | Uses | 2,2'-Dimethoxy-1,1'-binaphthyl is used as organic chemical synthesis intermediate. |
| | (R)-(+)-2,2'-DIMETHOXY-1,1'-BINAPHTHYL Preparation Products And Raw materials |
|