| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
3'-(O-Methyl)cytidine manufacturers
|
| | 3'-(O-Methyl)cytidine Basic information |
| | 3'-(O-Methyl)cytidine Chemical Properties |
| Boiling point | 506.0±60.0 °C(Predicted) | | density | 1.68±0.1 g/cm3(Predicted) | | pka | 13.34±0.70(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C10H15N3O5/c1-17-8-5(4-14)18-9(7(8)15)13-3-2-6(11)12-10(13)16/h2-3,5,7-9,14-15H,4H2,1H3,(H2,11,12,16)/t5-,7-,8-,9-/m1/s1 | | InChIKey | RZJCFLSPBDUNDH-ZOQUXTDFSA-N | | SMILES | OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)[C@H](O)[C@@H]1OC |
| | 3'-(O-Methyl)cytidine Usage And Synthesis |
| Uses | 3′-O-Methylcytidine is a cytidine analog. Cytidine analogs have a mechanism of inhibiting DNA methyltransferases (such as Zebularine, HY-13420), and have potential anti-metabolic and anti-tumor activities[1]. | | Definition | ChEBI: 3'-O-Methylcytidine is a pyrimidine nucleoside. | | References | [1] Gowher H, et al. Mechanism of inhibition of DNA methyltransferases by cytidine analogs in cancer therapy. Cancer Biol Ther. 2004 Nov;3(11):1062-8. DOI:10.4161/cbt.3.11.1308 |
| | 3'-(O-Methyl)cytidine Preparation Products And Raw materials |
|