| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
3-Methyl uridine manufacturers
- 3-Methyluridine
-
- $48.00
-
2026-07-17
- CAS:2140-69-4
- Purity: 99.79%
- Supply Ability: 10g
- 3-Methyluridine
-
- $48.00
-
2026-07-17
- CAS:2140-69-4
- Purity: 99.79%
- Supply Ability: 10g
|
| | 3-Methyl uridine Basic information |
| Product Name: | 3-Methyl uridine | | Synonyms: | Nsc 246077;Uridine, 3-methyl- (8ci)(9ci);Uridine, 3-methyl-;1-((2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-3-methylpyrimidine-2,4(1H,3H)-dione;3Methyluridine,N3-Methyluridine,RNA,m3U,3-Methyluridine,RNA modification,Inhibitor,18S,16S rRNA,25S,23S rRNA,3 Methyluridine,Endogenous Metabolite,inhibit;RNA-modified?nucleoside?m3U;3-Methyluridine, 10 mM in DMSO | | CAS: | 2140-69-4 | | MF: | C10H14N2O6 | | MW: | 258.23 | | EINECS: | | | Product Categories: | | | Mol File: | 2140-69-4.mol |  |
| | 3-Methyl uridine Chemical Properties |
| Melting point | 108-110 °C | | Boiling point | 501.1±60.0 °C(Predicted) | | density | 1.605±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated), Water (Slightly, Sonicated) | | pka | 13.26±0.70(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C10H14N2O6/c1-11-6(14)2-3-12(10(11)17)9-8(16)7(15)5(4-13)18-9/h2-3,5,7-9,13,15-16H,4H2,1H3/t5-,7-,8-,9-/m1/s1 | | InChIKey | UTQUILVPBZEHTK-ZOQUXTDFSA-N | | SMILES | OC[C@H]1O[C@@H](N2C=CC(=O)N(C)C2=O)[C@H](O)[C@@H]1O |
| | 3-Methyl uridine Usage And Synthesis |
| Uses | 3-Methyluridine can be used in biological and analytical studies of comprehensive profiling of ribonucleosides modification by affinity zirconium oxide-silica composite monolithic column online solid-phase microextraction - mass spectrometry analysis. |
| | 3-Methyl uridine Preparation Products And Raw materials |
|