| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 3-Hydroxy-2-acetylaminofluorene Basic information |
| Product Name: | 3-Hydroxy-2-acetylaminofluorene | | Synonyms: | 3-HO-AAF;N-(3-Hydroxy-9H-fluoren-2-yl)acetamide;Acetamide, N-(3-hydroxy-9H-fluoren-2-yl)-;Inchi=1/C15H13no2/C1-9(17)16-14-7-11-6-10-4-2-3-5-12(10)13(11)8-15(14)18/H2-5,7-8,18H,6H2,1H3,(H,16,17;2-ACETAMIDO-3-HYDROXYFLUORENE;3-Hydroxy-2-acetamidofluorene;3-Hydroxy-2-acetylaminofluorene | | CAS: | 1838-56-8 | | MF: | C15H13NO2 | | MW: | 239.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1838-56-8.mol |  |
| | 3-Hydroxy-2-acetylaminofluorene Chemical Properties |
| Melting point | 237-238 °C(Solv: acetic acid (64-19-7)) | | Boiling point | 381.93°C (rough estimate) | | density | 1.1198 (rough estimate) | | refractive index | 1.5500 (estimate) | | pka | 9.56±0.20(Predicted) |
| | 3-Hydroxy-2-acetylaminofluorene Usage And Synthesis |
| Uses | 3-Hydroxy-N-acetyl-2-aminofluorene is a reactive metabolite of 2-acetylaminofluorene, which is responsible for mediating the increase gene transcription and expression. Carcinogen. | | Definition | ChEBI: 3-Hydroxy-2-acetamidofluorene is a member of fluorenes. |
| | 3-Hydroxy-2-acetylaminofluorene Preparation Products And Raw materials |
|