| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1,6-Diamino-2,2,4(2,4,4)-trimethylhexane Basic information |
| Product Name: | 1,6-Diamino-2,2,4(2,4,4)-trimethylhexane | | Synonyms: | 2,2,4(2,4,4)-TRIMETHYL-1,6-HEXANEDIAMINE;C,C,C-TRIMETHYL-1,6-HEXANEDIAMINE;1,6-Hexanediamine,C,C,C-trimethyl-;6-Hexanediamine,C,C,C-trimethyl-1;c,c,c-trimethyl-6-hexanediamine;trimethylhexamethylene;trimethylhexamethylenediamines;trimethylhexamethylenediamine, mixed isomers | | CAS: | 25620-58-0 | | MF: | C18H44N4 | | MW: | 316.57 | | EINECS: | 247-134-8 | | Product Categories: | | | Mol File: | 25620-58-0.mol |  |
| | 1,6-Diamino-2,2,4(2,4,4)-trimethylhexane Chemical Properties |
| Melting point | 37.5°C (estimate) | | Boiling point | 232 °C(lit.) | | density | 0.867 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.464(lit.) | | Fp | 220 °F | | form | liquid | | InChI | 1S/2C9H22N2/c1-8(7-11)6-9(2,3)4-5-10;1-8(4-5-10)6-9(2,3)7-11/h2*8H,4-7,10-11H2,1-3H3 | | InChIKey | IXIXPOVPUKTPFV-UHFFFAOYSA-N | | SMILES | CC(CN)CC(C)(C)CCN.CC(CCN)CC(C)(C)CN | | EPA Substance Registry System | Trimethylhexamethylenediamine (25620-58-0) |
| Hazard Codes | C,N | | Risk Statements | 22-34-43-52/53 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2327 8/PG 3 | | WGK Germany | 2 | | F | 34 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Skin Corr. 1B
Skin Sens. 1 |
| | 1,6-Diamino-2,2,4(2,4,4)-trimethylhexane Usage And Synthesis |
| General Description | A colorless to light yellow liquid. Insoluble in water and less dense than water. Contact may severely irritate skin, eyes and mucous membranes. May be toxic by ingestion, inhalation and skin absorption. Used to make other chemicals. | | Air & Water Reactions | Insoluble in water. | | Reactivity Profile | Amines, such as TRIMETHYLHEXAMETHYLENEDIAMINE, are chemical bases. They neutralize acids to form salts plus water. These acid-base reactions are exothermic. The amount of heat that is evolved per mole of amine in a neutralization is largely independent of the strength of the amine as a base. Amines may be incompatible with isocyanates, halogenated organics, peroxides, phenols (acidic), epoxides, anhydrides, and acid halides. Flammable gaseous hydrogen is generated by amines in combination with strong reducing agents, such as hydrides. | | Health Hazard | INHALATION: Irritating to mucous membranes. EYES and SKIN: Irritation. INGESTION: May be harmful if swallowed. |
| | 1,6-Diamino-2,2,4(2,4,4)-trimethylhexane Preparation Products And Raw materials |
|