|
|
| | 3-bromo-4-methyl-1,2,4-triazole Basic information |
| Product Name: | 3-bromo-4-methyl-1,2,4-triazole | | Synonyms: | 3-bromo-4-methyl-1,2,4-triazole;3-broMo-4-Methyl-4H-1,2,4-triazole;MFCD10696422;4H-1,2,4-Triazole, 3-bromo-4-methyl-;4H-1,2,4-Triazole,3-bromo-4-methyl- | | CAS: | 16681-73-5 | | MF: | C3H4BrN3 | | MW: | 161.99 | | EINECS: | | | Product Categories: | API intermediates | | Mol File: | 16681-73-5.mol |  |
| | 3-bromo-4-methyl-1,2,4-triazole Chemical Properties |
| Boiling point | 255.9±23.0 °C(Predicted) | | density | 1.93±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | 0.54±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C3H4BrN3/c1-7-2-5-6-3(7)4/h2H,1H3 | | InChIKey | PYMVKLCRJYMSGC-UHFFFAOYSA-N | | SMILES | N1=CN(C)C(Br)=N1 |
| | 3-bromo-4-methyl-1,2,4-triazole Usage And Synthesis |
| | 3-bromo-4-methyl-1,2,4-triazole Preparation Products And Raw materials |
|