| Company Name: |
Cochemical Ltd. Gold |
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
|
| | 3-Fluoro-4-piperazinylbenzenecarbonitrile Basic information |
| | 3-Fluoro-4-piperazinylbenzenecarbonitrile Chemical Properties |
| Boiling point | 372.2±42.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 8+-.0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H12FN3/c12-10-7-9(8-13)1-2-11(10)15-5-3-14-4-6-15/h1-2,7,14H,3-6H2 | | InChIKey | VMOBEAUQUPPPON-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(N2CCNCC2)C(F)=C1 |
| | 3-Fluoro-4-piperazinylbenzenecarbonitrile Usage And Synthesis |
| | 3-Fluoro-4-piperazinylbenzenecarbonitrile Preparation Products And Raw materials |
|