| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | 8-Bromo-[1,6]naphthyridin-2-ol Basic information |
| | 8-Bromo-[1,6]naphthyridin-2-ol Chemical Properties |
| Boiling point | 412.1±45.0 °C(Predicted) | | density | 1.711±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 9.95±0.20(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H5BrN2O/c9-6-4-10-3-5-1-2-7(12)11-8(5)6/h1-4H,(H,11,12) | | InChIKey | QDOLSUHXUOKZJY-UHFFFAOYSA-N | | SMILES | N1C2=C(C=NC=C2Br)C=CC1=O | | CAS DataBase Reference | 902837-41-6 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 8-Bromo-[1,6]naphthyridin-2-ol Usage And Synthesis |
| Uses | 8-Bromo-1,6-naphthyridin-2(1H)-one is used as pharmaceutical intermediate. |
| | 8-Bromo-[1,6]naphthyridin-2-ol Preparation Products And Raw materials |
|