| Company Name: |
Jiangsu Aikon Biopharmaceutical R&D co.,Ltd.
|
| Tel: |
025-66028182 17714375163 |
| Email: |
yftan@aikonchem.com |
| Products Intro: |
Product Name:2H-Isoindole-2-acetic acid, 1,3-dihydro-4-nitro-1,3-dioxo-
CAS:15784-35-7
Purity:95+% Package:1g;5g;10g
|
| Company Name: |
Changzhou Qianai Biotechnology Co., Ltd
|
| Tel: |
051915240519135 13961152745 |
| Email: |
yudiguimo@126.COM |
| Products Intro: |
Product Name:2-(4-nitro-1,3-dioxoisoindolin-2-yl)acetic acid
CAS:15784-35-7
Purity:98% Package:5g；10g；50g；100g；500g；1kg
|
|
| | (4-NITRO-1,3-DIOXO-1,3-DIHYDRO-ISOINDOL-2-YL)-ACETIC ACID Basic information |
| Product Name: | (4-NITRO-1,3-DIOXO-1,3-DIHYDRO-ISOINDOL-2-YL)-ACETIC ACID | | Synonyms: | (S)-2-((S)-3-Carboxymethyl-2-oxo-2,3-dihydro-imidazo[1,2-a]pyridin-3-yl)- succinic acid;2-(4-nitro-1,3-dioxoisoindolin-2-yl)acetic acid;2H-Isoindole-2-acetic acid, 1,3-dihydro-4-nitro-1,3-dioxo-;2-(4-Nitro-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)acetic Acid;1,3-Dihydro-4-nitro-1,3-dioxo-2H-isoindole-2-acetic acid;(4-Nitro-1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid | | CAS: | 15784-35-7 | | MF: | C10H6N2O6 | | MW: | 250.16 | | EINECS: | | | Product Categories: | | | Mol File: | 15784-35-7.mol |  |
| | (4-NITRO-1,3-DIOXO-1,3-DIHYDRO-ISOINDOL-2-YL)-ACETIC ACID Chemical Properties |
| Melting point | 213.5-214.2 °C(Solv: water (7732-18-5)) | | Boiling point | 517.7±35.0 °C(Predicted) | | density | 1.706±0.06 g/cm3(Predicted) | | form | solid | | pka | 3.43±0.10(Predicted) | | InChI | 1S/C10H6N2O6/c13-7(14)4-11-9(15)5-2-1-3-6(12(17)18)8(5)10(11)16/h1-3H,4H2,(H,13,14) | | InChIKey | VEVGTTUIMHJYSO-UHFFFAOYSA-N | | SMILES | [N+](=O)([O-])c1c2c(ccc1)C(=O)N(C2=O)CC(=O)O |
| Risk Statements | 36 | | Safety Statements | 26 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2 |
| | (4-NITRO-1,3-DIOXO-1,3-DIHYDRO-ISOINDOL-2-YL)-ACETIC ACID Usage And Synthesis |
| | (4-NITRO-1,3-DIOXO-1,3-DIHYDRO-ISOINDOL-2-YL)-ACETIC ACID Preparation Products And Raw materials |
|