|
|
| | (R)-1-N-Boc-3-methylamino piperidine Basic information |
| Product Name: | (R)-1-N-Boc-3-methylamino piperidine | | Synonyms: | 1-N-Boc-3-(R)-Methylamino-piperidine;(R)-3-Methylamino-piperidine-1-c;(R)-1-Boc-3-(MethylaMino)piperidine;R-N-Boc-3-MethylaMino piperidine;(R)-1-Boc-3-MethylaMinopieridine;tert-Butyl (R)-3-(methylamino)piperidine-1-carboxylate;tert-butyl (3R)-3-(methylamino)piperidine-1-carboxylate;1-Piperidinecarboxylic acid, 3-(methylamino)-, 1,1-dimethylethyl ester, (3R)- | | CAS: | 203941-94-0 | | MF: | C11H22N2O2 | | MW: | 214.3 | | EINECS: | | | Product Categories: | | | Mol File: | 203941-94-0.mol |  |
| | (R)-1-N-Boc-3-methylamino piperidine Chemical Properties |
| Boiling point | 289.0±33.0 °C(Predicted) | | density | 1.01±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 10.10±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-7-5-6-9(8-13)12-4/h9,12H,5-8H2,1-4H3/t9-/m1/s1 | | InChIKey | XRRRUOWSHGFPTI-SECBINFHSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC[C@@H](NC)C1 |
| | (R)-1-N-Boc-3-methylamino piperidine Usage And Synthesis |
| | (R)-1-N-Boc-3-methylamino piperidine Preparation Products And Raw materials |
|