|
|
| | BIS(2-ETHYLHEXYL)ISOPHTHALATE Basic information |
| Product Name: | BIS(2-ETHYLHEXYL)ISOPHTHALATE | | Synonyms: | DI-(2-ETHYLHEXYL) ISOPHTHALATE;BIS(2-ETHYLHEXYL)ISOPHTHALATE;Bis-(2-ethylhexyl)ester kyseliny isoftalove;Flexol plasticizer 380;Isophthalic acid, bis(2-ethylhexyl) ester;Isophthalic acid, di-(2-ethylhexyl)ester;DIETHYLHEXYLISOPHTHALATE;benzene-1,3-dicarboxylic acid bis(2-ethylhexyl) ester | | CAS: | 137-89-3 | | MF: | C24H38O4 | | MW: | 390.56 | | EINECS: | 205-308-0 | | Product Categories: | | | Mol File: | 137-89-3.mol |  |
| | BIS(2-ETHYLHEXYL)ISOPHTHALATE Chemical Properties |
| Melting point | -46 | | Boiling point | 211°C/2mmHg(lit.) | | density | 1.0101 (rough estimate) | | refractive index | 1.4860 to 1.4900 | | Fp | 233°C(lit.) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Liquid | | color | Colourless | | Water Solubility | 11ug/L(24 ºC) | | BRN | 2162836 | | Major Application | cleaning products
cosmetics
food and beverages
personal care | | InChI | 1S/C24H38O4/c1-5-9-12-19(7-3)17-27-23(25)21-14-11-15-22(16-21)24(26)28-18-20(8-4)13-10-6-2/h11,14-16,19-20H,5-10,12-13,17-18H2,1-4H3 | | InChIKey | WXZOXVVKILCOPG-UHFFFAOYSA-N | | SMILES | O(CC(CCCC)CC)C(=O)c1cc(ccc1)C(=O)OCC(CCCC)CC | | EPA Substance Registry System | Bis(2-ethylhexyl) isophthalate (137-89-3) |
| Hazard Codes | T,N | | Risk Statements | 60-61-50 | | Safety Statements | 53-45-61 | | RIDADR | UN 3082 9 / PGIII | | WGK Germany | 3 | | RTECS | NT2050000 | | TSCA | TSCA listed | | HS Code | 2917.39.7000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Acute 1
Repr. 1B |
| | BIS(2-ETHYLHEXYL)ISOPHTHALATE Usage And Synthesis |
| Chemical Properties | Di(2-ethylhexyl) isophthalate has a water solubility of less
than 0.1 g/100mL at 16℃. It is a colorless liquid. | | Uses | Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. | | General Description | Clear light yellow viscous liquid. | | Air & Water Reactions | Insoluble in water. | | Reactivity Profile | BIS(2-ETHYLHEXYL)ISOPHTHALATE is an ester. Esters react with acids to liberate heat along with alcohols and acids. Strong oxidizing acids may cause a vigorous reaction that is sufficiently exothermic to ignite the reaction products. Heat is also generated by the interaction of esters with caustic solutions. Flammable hydrogen is generated by mixing esters with alkali metals and hydrides. | | Health Hazard | ACUTE/CHRONIC HAZARDS: When heated to decomposition BIS(2-ETHYLHEXYL)ISOPHTHALATE emits acrid smoke and irritating fumes. | | Fire Hazard | BIS(2-ETHYLHEXYL)ISOPHTHALATE is probably combustible. |
| | BIS(2-ETHYLHEXYL)ISOPHTHALATE Preparation Products And Raw materials |
|