| Company Name: |
Lynnchem |
| Tel: |
86-(0)29-85992781 17792393971 |
| Email: |
info@lynnchem.com |
3-Benzoyl-7-diethylaminocoumarin manufacturers
|
| | 3-Benzoyl-7-diethylaminocoumarin Basic information |
| Product Name: | 3-Benzoyl-7-diethylaminocoumarin | | Synonyms: | 3-benzoyl-7-(N,N-diethylamino)coumarin;2H-1-Benzopyran-2-one,3-benzoyl-7-(diethylamino)-;3-benzoyl-7-(diethylamino)chromen-2-one;7-Diethylamino-3-benzoyl-coumarine;3-Benzoyl-7-(diethylamino)-2H-1-benzopyran-2-one;3-benzeneformyl-7-(diethylamino)-2H-1-benzenebenzo2-pyranone;3-Benzoyl-7-diethylaminocoumarin | | CAS: | 77016-78-5 | | MF: | C20H19NO3 | | MW: | 321.37 | | EINECS: | | | Product Categories: | | | Mol File: | 77016-78-5.mol |  |
| | 3-Benzoyl-7-diethylaminocoumarin Chemical Properties |
| InChI | InChI=1S/C20H19NO3/c1-3-21(4-2)16-11-10-15-12-17(20(23)24-18(15)13-16)19(22)14-8-6-5-7-9-14/h5-13H,3-4H2,1-2H3 | | InChIKey | CPVJWBWVJUAOMV-UHFFFAOYSA-N | | SMILES | C1(=O)OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)C1=CC=CC=C1 |
| | 3-Benzoyl-7-diethylaminocoumarin Usage And Synthesis |
| Uses | 3-BENZOYL-7-DIETHYLAMINOCOUMARIN is used as a sealant for fluorescent probe dyes and liquid crystal display elements. |
| | 3-Benzoyl-7-diethylaminocoumarin Preparation Products And Raw materials |
|