L-FELININE manufacturers
- L-FELININE
-
- $1.00
-
2026-08-07
- CAS:471-09-0
- Min. Order: 1KG
- Purity: 95%
- Supply Ability: 300KG
|
| | L-FELININE Basic information |
| | L-FELININE Chemical Properties |
| Melting point | 162-164°C | | alpha | D25 -11.5° (c = 2.81 in water) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Tan | | InChI | InChI=1S/C8H17NO3S/c1-8(2,3-4-10)13-5-6(9)7(11)12/h6,10H,3-5,9H2,1-2H3,(H,11,12)/t6-/m0/s1 | | InChIKey | IFERABFGYYJODC-LURJTMIESA-N | | SMILES | C(O)(=O)[C@H](CSC(C)(C)CCO)N |
| | L-FELININE Usage And Synthesis |
| Chemical Properties | Off-White to Pale Yellow Solid | | Uses | An amino acid found in the urine of species of the Felidae family, is believed to either possess pheromone activity or give rise to compounds with such activity. | | Definition | ChEBI: A cysteine thioether that is the S-(4-hydroxy-2-methylbutan-2-yl) derivative of L-cysteine. It is a major component of the urine of the domestic cat. |
| | L-FELININE Preparation Products And Raw materials |
|