| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (S)-4-benzylmorpholine-2-carboxylic acid Basic information |
| | (S)-4-benzylmorpholine-2-carboxylic acid Chemical Properties |
| storage temp. | 2-8°C | | form | solid | | InChI | 1S/C12H15NO3/c14-12(15)11-9-13(6-7-16-11)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,14,15)/t11-/m0/s1 | | InChIKey | UJDWIUOGWSDEFP-NSHDSACASA-N | | SMILES | O=C(O)[C@@H]1CN(CC2=CC=CC=C2)CCO1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
| | (S)-4-benzylmorpholine-2-carboxylic acid Usage And Synthesis |
| | (S)-4-benzylmorpholine-2-carboxylic acid Preparation Products And Raw materials |
|