| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine Basic information |
| Product Name: | 1-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine | | Synonyms: | 3-(Piperidin-1-yl)benzeneboronic acid, pinacol ester;3-Piperidinophenylboronic acid, pinacol ester;Piperidine, 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-;1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pip...;1- [3-(4,4,5,5-tetramethyl-1,3,2-dioxanborane-2-yl)phenyl]piperidine;1-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperidine - [T92827];1-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine | | CAS: | 852227-97-5 | | MF: | C17H26BNO2 | | MW: | 287.2 | | EINECS: | | | Product Categories: | | | Mol File: | 852227-97-5.mol | ![1-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine Structure](CAS/GIF/852227-97-5.gif) |
| | 1-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine Chemical Properties |
| Melting point | 156 °C | | Boiling point | 419.4±28.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 5.47±0.40(Predicted) | | Appearance | Brown to reddish brown Solid | | InChI | 1S/C17H26BNO2/c1-16(2)17(3,4)21-18(20-16)14-9-8-10-15(13-14)19-11-6-5-7-12-19/h8-10,13H,5-7,11-12H2,1-4H3 | | InChIKey | IIUXWPXCCXVCPD-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2cccc(c2)N3CCCCC3 |
| WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | 1-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine Usage And Synthesis |
| | 1-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine Preparation Products And Raw materials |
|