|
|
| | 1,1,3,3-Tetramethyl-1,3-diethoxydisiloxane Basic information |
| Product Name: | 1,1,3,3-Tetramethyl-1,3-diethoxydisiloxane | | Synonyms: | 1,3-DIETHOXYTETRAMETHYLDISILOXANE;1,3-DIETHOXY-1,1,3,3-TETRAMETHYLDISILOXANE;1,3-diethoxy-1,1,3,3-tetramethyl-disiloxan;Tetramethyldiethoxydisiloxane;Disiloxane,1,3-diethoxy-1,1,3,3-tetramethyl-;1,1,3,3-Tetramethyl-1,3-diethoxypropanedisiloxane;1,3-Diethoxy-1,1,3,3-tetramethylpropanedisiloxane;1,1,3,3-TETRAMETHYL-1,3-DIETHOXYDISILOXANE 97% | | CAS: | 18420-09-2 | | MF: | C8H22O3Si2 | | MW: | 222.43 | | EINECS: | 242-298-7 | | Product Categories: | Di-Alkoxy SilanesOrganometallic Reagents;Organosilicon;Self Assembly&Contact Printing;Silane Coupling Agents/Adhesion Promoters;Siloxanes;Chemical Synthesis;Contact Printing;Di-Alkoxy Silanes;Materials Science;Micro/NanoElectronics;Organometallic Reagents;Self Assembly &Silane Coupling Agents/Adhesion Promoters | | Mol File: | 18420-09-2.mol |  |
| | 1,1,3,3-Tetramethyl-1,3-diethoxydisiloxane Chemical Properties |
| Melting point | -134°C | | Boiling point | 161 °C (lit.) | | density | 0.883 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.389(lit.) | | Fp | 110 °F | | solubility | Chloroform (Soluble), Methanol (Slightly) | | form | Oil | | color | Colourless | | Specific Gravity | 0.879 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | 1S/C8H22O3Si2/c1-7-9-12(3,4)11-13(5,6)10-8-2/h7-8H2,1-6H3 | | InChIKey | NPOYZXWZANURMM-UHFFFAOYSA-N | | SMILES | CCO[Si](C)(C)O[Si](C)(C)OCC | | EPA Substance Registry System | Disiloxane, 1,3-diethoxy-1,1,3,3-tetramethyl- (18420-09-2) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29319090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | 1,1,3,3-Tetramethyl-1,3-diethoxydisiloxane Usage And Synthesis |
| Uses | 1,3-Diethoxy-1,1,3,3-tetramethyldisiloxane is used in preparation of symmetric Alkoxy-substituted Alkyldisiloxanes by alkoxy partial hydrolysis of alkoxysilanes, carbonization and condensation |
| | 1,1,3,3-Tetramethyl-1,3-diethoxydisiloxane Preparation Products And Raw materials |
|