| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Vinyltriphenylphosphonium bromide Basic information | | Uses |
| | Vinyltriphenylphosphonium bromide Chemical Properties |
| Melting point | 176-178 °C (lit.) | | storage temp. | 2-8°C | | form | solid | | Appearance | White to off-white Solid | | Sensitive | Light Sensitive & Hygroscopic | | BRN | 4168860 | | InChI | InChI=1S/C20H18P.BrH/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;/h2-17H,1H2;1H/q+1;/p-1 | | InChIKey | VRAYVWUMBAJVGH-UHFFFAOYSA-M | | SMILES | [P+](C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC=CC=1)C=C.[Br-] | | CAS DataBase Reference | 5044-52-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Vinyltriphenylphosphonium bromide Usage And Synthesis |
| Uses | Triphenylvinylphosphonium Bromide has been used to enhance the thermal stability of epoxy resin. It is commonly used as a Wittig reagent. | | Chemical Properties | WHITE TO BEIGE FINE CRYSTALLINE POWDER | | Uses | Reactant involved in:
- Asymmetric conjugate addition and intramolecular cyclization
- Condensation with benzoxazinediones
- Intramolecular dehydrobromination
- Schweizer reaction
- Cycloaddition with nitro ketone Baylis-Hillman adducts
', 'Reagent for the synthesis of heterocycles. | | Preparation | The preparation of TriphenylvinylphosphoniuM BroMide has been accomplished by treatment of ethylenebis(triphenylphosphonium) dibromide with borate ion (32%), (2-chloroethyl)triphenylphosphonium bromide with Triethylamine (72%), (2-bromoethyl)triphenylphosphonium bromide with Silver(I) Oxide (85%), and (2- phenoxyethyl)triphenylphosphonium bromide with boiling ethyl acetate (92%). | | reaction suitability | reaction type: C-C Bond Formation | | storage | hygroscopic; irritant; produces sneezing in many individuals. Use in a fume hood. |
| | Vinyltriphenylphosphonium bromide Preparation Products And Raw materials |
|