- Ferrosu Oxalate
-
-
2026-03-22
- CAS:6047-25-2
- Min. Order: 25KG
- Purity: 98.5%min
- Supply Ability: 200 tons
|
| | Ferrous oxalate dihydrate Basic information |
| Product Name: | Ferrous oxalate dihydrate | | Synonyms: | FERROUS OXALATE 2H2O;FERROUS OXALATE DIHYDRATE;IRON(II) OXALATE;IRON(II) OXALATE DIHYDRATE;Ferrousoxalatedihydrate(α-form);Ironprotoxalate;Ironoxalatedihydrateminyellowpowder;Iron(Ⅱ) oxalate | | CAS: | 6047-25-2 | | MF: | C2H2FeO6 | | MW: | 177.88 | | EINECS: | 611-981-5 | | Product Categories: | salt of an organic acid | | Mol File: | 6047-25-2.mol |  |
| | Ferrous oxalate dihydrate Chemical Properties |
| Melting point | 190°C (dec.) | | density | 2.28 g/mL at 25 °C(lit.) | | solubility | soluble in acid solutions | | form | Powder | | Specific Gravity | 2.28 | | color | yellow | | Water Solubility | Soluble in water. Insoluble in acetic acid. | | Sensitive | Hygroscopic | | BRN | 3757620 | | Solubility Product Constant (Ksp) | pKsp: 6.5 | | Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: TWA 1 mg/m3 | | Stability: | Stable. Hygroscopic. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C2H2O4.Fe.2H2O/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);;2*1H2/q;+4;;/p-4 | | InChIKey | HONIVWKVENJCTE-UHFFFAOYSA-J | | SMILES | O[Fe+2]1([O-]C(=O)C(=O)[O-]1)O | | CAS DataBase Reference | 6047-25-2(CAS DataBase Reference) | | EPA Substance Registry System | Iron, diaqua[ethanedioato(2-)-.kappa.O1,.kappa.O2]-, (T-4)- (6047-25-2) |
| Hazard Codes | Xn | | Risk Statements | 21/22 | | Safety Statements | 24/25 | | RIDADR | 3288 | | WGK Germany | 1 | | TSCA | Yes | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral |
| | Ferrous oxalate dihydrate Usage And Synthesis |
| Description | Iron(II) oxalate, FeC204.2H20, is precipitated as yellow crystals from solutions
containing iron(II) and oxalate ions ; in the presence of excess alkali metal oxalate, however,
soluble oxalato complexes M2[Fe(C2O4)2] are formed which can be precipitated by the
addition of alcohol. The oxalate is paramagnetic with μeff= 5·2 B.M. at room temperature. | | Chemical Properties | yellow powder
Ferrous oxalate, or iron(II) oxalate, is a chemical compound consisting of one iron(II) ion (Fe2) and one oxalate ion (C2O4(2−)). It has the chemical formula FeC2O4. Iron(II) oxalate is more commonly encountered as the dihydrate, FeC2O4·2H2O, CAS # 6047-25-2. Its crystal structure consists of chains of oxalate-bridged iron atoms, capped by water molecules. When heated, it dehydrates and decomposes into carbon dioxide, carbon monoxide, iron oxides and pyrophoric black iron. |
| | Ferrous oxalate dihydrate Preparation Products And Raw materials |
|