|
|
| | 4'-Methoxybiphenyl-4-carbaldehyde Basic information |
| Product Name: | 4'-Methoxybiphenyl-4-carbaldehyde | | Synonyms: | [1,1'-BIPHENYL]-4-CARBOXALDEHYDE, 4'-METHOXY-;AKOS BAR-0060;4'-METHOXY-BIPHENYL-4-CARBALDEHYDE;4'-METHOXY-BIPHENYL-4-CARBOXALDEHYDE;4'-METHOXY[1,1'-BIPHENYL]-4-CARBOXALDEHYDE;4'-METHOXY[1,1'-BIPHENYL]-4-CARBALDEHYDE;TIMTEC-BB SBB010160;4-(4-METHOXYPHENYL)BENZALDEHYDE | | CAS: | 52988-34-8 | | MF: | C14H12O2 | | MW: | 212.24 | | EINECS: | | | Product Categories: | | | Mol File: | 52988-34-8.mol |  |
| | 4'-Methoxybiphenyl-4-carbaldehyde Chemical Properties |
| Melting point | 98-100°C | | Fp | >110°(230°F) | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | Sensitive | Air Sensitive | | InChI | 1S/C14H12O2/c1-16-14-8-6-13(7-9-14)12-4-2-11(10-15)3-5-12/h2-10H,1H3 | | InChIKey | JTTIGLYPLMYHAT-UHFFFAOYSA-N | | SMILES | COc1ccc(cc1)-c2ccc(C=O)cc2 | | CAS DataBase Reference | 52988-34-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2912490090 | | Storage Class | 13 - Non Combustible Solids |
| | 4'-Methoxybiphenyl-4-carbaldehyde Usage And Synthesis |
| Uses | 4''-Methoxybiphenyl-4-carboxaldehyde acts as a reagent in the research studies involving the use of aryliden-methyloxazolones as reversible MAGL inhibitors for cancer treatment. |
| | 4'-Methoxybiphenyl-4-carbaldehyde Preparation Products And Raw materials |
|