|
|
| | Methyl 5-allyl-3-methoxysalicylate Basic information |
| | Methyl 5-allyl-3-methoxysalicylate Chemical Properties |
| Melting point | 54-58 °C (lit.) | | Boiling point | 174°C/12mmHg(lit.) | | density | 1.144±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | pka | 10.10±0.23(Predicted) | | color | White to Almost white | | InChI | 1S/C12H14O4/c1-4-5-8-6-9(12(14)16-3)11(13)10(7-8)15-2/h4,6-7,13H,1,5H2,2-3H3 | | InChIKey | LYSUGZLJKRSLHM-UHFFFAOYSA-N | | SMILES | COC(=O)c1cc(CC=C)cc(OC)c1O | | CAS DataBase Reference | 85614-43-3(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Methyl 5-allyl-3-methoxysalicylate Usage And Synthesis |
| Chemical Properties | White to pale yellow powder | | Uses | Methyl 5-Allyl-3-methoxysalicylate is a reactant in the synthesis of Fallypride (F101115), enterobactin scaffolds and allylic amines. |
| | Methyl 5-allyl-3-methoxysalicylate Preparation Products And Raw materials |
|