| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Kemp's triacid Basic information |
| Product Name: | Kemp's triacid | | Synonyms: | 1,3,5-Trimethylcyclohexane-1β,3β,5β-tricarboxylic acid;cis,cis-1,3,5-Trimethyl-1,3,5-cyclohexanetricarboxylic acid;CIS,CIS-1,3,5-TRIMETHYLCYCLOHEXANE-1,3,5-TRICARBOXYLIC ACID;cis,cis-1,3,5-trime.cyclohexane-1,3,5-tricarboxylic acid;1,3,5-Trimethyl-1,3,5-cyclohexanetricarboxylicacid(Kemp'striacid);Aluminum oxide, fused, #200+325 mesh, 99+% metals basis;cis,cis-1,3,5-Trimethyl-1,3,5-cyclohexanetricarboxylic acid (Kemp''s triacid);cis,cis-1,3,5-Trimethylcyclohexane-1,3,5-tricarboxylic acid 99% | | CAS: | 79410-20-1 | | MF: | C12H18O6 | | MW: | 258.27 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 79410-20-1.mol |  |
| | Kemp's triacid Chemical Properties |
| Melting point | 241-243 °C(lit.) | | Boiling point | 364.0±42.0 °C(Predicted) | | density | 1.301±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.02±0.50(Predicted) | | BRN | 3557263 | | InChI | 1S/C12H18O6/c1-10(7(13)14)4-11(2,8(15)16)6-12(3,5-10)9(17)18/h4-6H2,1-3H3,(H,13,14)(H,15,16)(H,17,18)/t10-,11+,12- | | InChIKey | AZWHPGZNOIYGFB-ZSBIGDGJSA-N | | SMILES | C[C@@]1(C[C@](C)(C[C@](C)(C1)C(O)=O)C(O)=O)C(O)=O | | CAS DataBase Reference | 79410-20-1 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Kemp's triacid Usage And Synthesis |
| Uses | Versatile molecule for molecular recognition studies. Also used to prepare a chiral auxiliary for asymmetric radical addition, allylation, and annulation reactions. | | Purification Methods | Recrystallise the tricarboxylic acid from Me2CO after re-precipitating it several times with mineral acid from aqueous alkaline soltion. The trimethyl ester has m 78-81o. [cf. Kemp J Org Chem 46 5140 1981, Jeong et al. J Am Chem Soc 113 201 1991, Stack et al. J Am Chem Soc 114 7007 1992.] |
| | Kemp's triacid Preparation Products And Raw materials |
|