| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3,3,3-Trifluoro-2-(trifluoromethyl)propionic acid manufacturers
|
| | 3,3,3-Trifluoro-2-(trifluoromethyl)propionic acid Basic information |
| Product Name: | 3,3,3-Trifluoro-2-(trifluoromethyl)propionic acid | | Synonyms: | ART-CHEM-BB B019695;AKOS B019695;2-(TRIFLUOROMETHYL)-3,3,3-TRIFLUOROPROPIONIC ACID;3,3,3-TRIFLUORO-2-(TRIFLUOROMETHYL)PROPANOIC ACID;2H-HEXAFLUOROISOBUTYRIC ACID;propanoic acid, 3,3,3-trifluoro-2-(trifluoromethyl)-;2H-Perfluoro-2-methylpropanoic acid;3,3,3-Trifluoro-2-(trifluoromethyl)propanoic acid, 3,3,3-Trifluoro-2-(trifluoromethyl)propionic acid | | CAS: | 564-10-3 | | MF: | C4H2F6O2 | | MW: | 196.05 | | EINECS: | | | Product Categories: | Building Blocks;C1 to C5;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks;C1 to C5;Carbonyl Compounds;Carboxylic Acids | | Mol File: | 564-10-3.mol |  |
| | 3,3,3-Trifluoro-2-(trifluoromethyl)propionic acid Chemical Properties |
| Melting point | 50-53 °C (lit.) | | Boiling point | 125/750mm | | density | 1.602±0.06 g/cm3(Predicted) | | pka | 1.53±0.10(Predicted) | | form | Crystalline Powder | | color | White | | InChI | 1S/C4H2F6O2/c5-3(6,7)1(2(11)12)4(8,9)10/h1H,(H,11,12) | | InChIKey | RAEAYTICAPHWJW-UHFFFAOYSA-N | | SMILES | OC(=O)C(C(F)(F)F)C(F)(F)F | | CAS DataBase Reference | 564-10-3(CAS DataBase Reference) | | EPA Substance Registry System | 2H-Perfluoroisobutyric acid (564-10-3) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 3261 | | WGK Germany | 3 | | HazardClass | CORROSIVE | | HS Code | 29159000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,3,3-Trifluoro-2-(trifluoromethyl)propionic acid Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | The behavior of 3,3,3-trifluoro-2-(trifluoromethyl)propionic acid was studied using ion-exclusion chromatography. |
| | 3,3,3-Trifluoro-2-(trifluoromethyl)propionic acid Preparation Products And Raw materials |
|