| Company Name: |
Bridge Organics |
| Tel: |
+1269-649-4200 |
| Email: |
ab@bridgeorganics.com |
|
| | 3-(3-THIENYL)-2-PROPENOIC ACID, METHYL ESTER Basic information |
| Product Name: | 3-(3-THIENYL)-2-PROPENOIC ACID, METHYL ESTER | | Synonyms: | 3-(3-THIENYL)-2-PROPENOIC ACID, METHYL ESTER;3-THIOPHEN-3-YL-ACRYLIC ACID METHYL ESTER;Methyl 3-(thiophen-3-yl)acrylate;(E)-methyl 3-(thiophen-3-yl)acrylate;3-THIOPHENE-3-YL-ACRYLIC ACID METHYL ESTER;3-(3-Thienyl)acrylic acid methyl ester;3-Thiopheneacrylic Acid methyl ester;2-Propenoic acid, 3-(3-thienyl)-, methyl ester | | CAS: | 135835-43-7 | | MF: | C8H8O2S | | MW: | 168.21 | | EINECS: | | | Product Categories: | API intermediates | | Mol File: | 135835-43-7.mol |  |
| | 3-(3-THIENYL)-2-PROPENOIC ACID, METHYL ESTER Chemical Properties |
| Boiling point | 261℃ | | density | 1.202 | | Fp | 111℃ | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; Ethanol:PBS (pH 7.2) (1:1): 0.5 mg/ml | | form | A crystalline solid | | InChI | InChI=1S/C8H8O2S/c1-10-8(9)3-2-7-4-5-11-6-7/h2-6H,1H3 | | InChIKey | ZBUKIESAKFXOHF-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C=CC1C=CSC=1 |
| | 3-(3-THIENYL)-2-PROPENOIC ACID, METHYL ESTER Usage And Synthesis |
| Description | 3-Thiopheneacrylic acid methyl ester is a synthetic intermediate useful for pharmaceutical synthesis. | | Uses | 3-Thio-pheneacrylic acid methyl ester is a synthetic intermediate useful for pharmaceutical synthesis. |
| | 3-(3-THIENYL)-2-PROPENOIC ACID, METHYL ESTER Preparation Products And Raw materials |
|