| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Ammonium heptafluorotantalate(V) Basic information |
| Product Name: | Ammonium heptafluorotantalate(V) | | Synonyms: | AMMONIUM HEPTAFLUOROTANTALATE;AMMONIUM HEPTAFLUOROTANTALATE 99.99%;AMMONIUM HEPTAFLUOROTANTALATE(V), 99.99%;diazanium,heptafluorotantalum(2-);AMMONIUM HEPTAFLUOROTANTALATE, 99.99%AMMONIUM HEPTAFLUOROTANTALATE, 99.99%AMMONIUM HEPTAFLUOROTANTALATE, 99.99%AMMONIUM HEPTAFLUOROTANTALATE, 99.99%;Ammonium heptafluorotantalate(V) 99.99% trace metals basis;iazanium,heptafluorotantalum(2-);Ammonium heptafluorotantalate(V) | | CAS: | 12022-02-5 | | MF: | F7H8N2Ta | | MW: | 350.01 | | EINECS: | | | Product Categories: | Ammonium Salts;Metal and Ceramic Science;Salts | | Mol File: | 12022-02-5.mol |  |
| | Ammonium heptafluorotantalate(V) Chemical Properties |
| form | crystalline | | color | hygroscopic crystals, crystalline | | InChI | 1S/7FH.2H3N.Ta/h7*1H;2*1H3;/q;;;;;;;;;+5/p-5 | | InChIKey | RDNGDFQMYLJTJR-UHFFFAOYSA-I | | SMILES | [NH4+].[NH4+].F[Ta--](F)(F)(F)(F)(F)F |
| Hazard Codes | C | | Risk Statements | 20/21/22-34 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | UN 3260 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| | Ammonium heptafluorotantalate(V) Usage And Synthesis |
| Chemical Properties | hygroscopic [ALD93] |
| | Ammonium heptafluorotantalate(V) Preparation Products And Raw materials |
|