|
|
| | 1,1,1-TRIFLUORO-2-(TRIFLUOROMETHYL)PENT-4-EN-2-OL Basic information |
| Product Name: | 1,1,1-TRIFLUORO-2-(TRIFLUOROMETHYL)PENT-4-EN-2-OL | | Synonyms: | BTHB;2-ALLYLHEXAFLUOROISOPROPANOL;1,1,1-TRIFLUORO-2-(TRIFLUOROMETHYL)PENT-4-EN-2-OL;1,1,1-TRIFLUORO-2-TRIFLUOROMETHYL-PENT-4-ENE-2-OL;1,1,1-Trifluoro-2-(trifluoromethyl)-4-penten-2-ol;2-Allylhexafluoroisopropanol 97%;2-Allylhexafluoroisopropanol97%;ALLYLHEXAFLUOROISO-PROPANOL | | CAS: | 646-97-9 | | MF: | C6H6F6O | | MW: | 208.1 | | EINECS: | 613-651-6 | | Product Categories: | | | Mol File: | 646-97-9.mol |  |
| | 1,1,1-TRIFLUORO-2-(TRIFLUOROMETHYL)PENT-4-EN-2-OL Chemical Properties |
| Boiling point | 97 °C | | density | 1.36g/ml | | refractive index | 1.3320 to 1.3360 | | Fp | 45° | | pka | 9.62±0.29(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C6H6F6O/c1-2-3-4(13,5(7,8)9)6(10,11)12/h2,13H,1,3H2 | | InChIKey | VHSCQANAKTXZTG-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C(C(F)(F)F)(O)CC=C | | CAS DataBase Reference | 646-97-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | 1987 | | Hazard Note | Irritant | | HazardClass | IRRITANT, LACHRYMATOR | | PackingGroup | III | | HS Code | 2905190098 |
| | 1,1,1-TRIFLUORO-2-(TRIFLUOROMETHYL)PENT-4-EN-2-OL Usage And Synthesis |
| Chemical Properties | liquid |
| | 1,1,1-TRIFLUORO-2-(TRIFLUOROMETHYL)PENT-4-EN-2-OL Preparation Products And Raw materials |
|