|
|
| | Thiabendazole-5-hydroxy Basic information |
| | Thiabendazole-5-hydroxy Chemical Properties |
| Boiling point | 525.6±48.0 °C(Predicted) | | density | 1.535±0.06 g/cm3(Predicted) | | storage temp. | 0-6°C | | solubility | DMF: 20 mg/ml; DMSO: 20 mg/ml; DMSO:PBS (pH 7.2) (1:20): 0.05 mg/ml; Ethanol: 0.5 mg/ml | | pka | 8.76±0.40(Predicted) | | Major Application | agriculture environmental forensics and toxicology veterinary | | InChI | InChI=1S/C10H7N3OS/c14-6-1-2-7-8(3-6)13-10(12-7)9-4-15-5-11-9/h1-5,14H,(H,12,13) | | InChIKey | VNENJHUOPQAPAT-UHFFFAOYSA-N | | SMILES | C1(C2=CSC=N2)NC2=CC(O)=CC=C2N=1 |
| Hazard Codes | Xn,N | | Risk Statements | 22-50/53 | | Safety Statements | 60-61 | | RIDADR | 3077 | | WGK Germany | 3 | | HazardClass | 9 | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 |
| | Thiabendazole-5-hydroxy Usage And Synthesis |
| Description | 5-hydroxy Thiabendazole (5-OH TBZ) is a major metabolite of the anthelmintic thiabendazole . Unlike thiabendazole, 5-OH TBZ has no effect on the growth of third-stage A. caninum larvae. | | Chemical Properties | Yellow Solid | | Uses | Labelled 5-Hydroxy Thiabendazole (H961200) | | Uses | A major metabolite of Thiabendazole | | Uses | 5-Hydroxy Thiabendazole is the major metabolite of Thiabendazole | | Definition | ChEBI: 5-Hydroxythiabendazole is a member of benzimidazoles. | | References | [1] ORVILLE J STONE M.D. Carolyn J W M A J Fred Mullins M D. Comparison of Thiabendazole and 5-Hydroxythiabendazole (for Anthelmintic Effect)*[J]. Journal of Investigative Dermatology, 1965, 45 2: Pages 132-133. DOI: 10.1038/jid.1965.107 |
| | Thiabendazole-5-hydroxy Preparation Products And Raw materials |
|