| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:OxazicloMefone
CAS:153197-14-9
Purity:100 μg/ML in Methanol Package:1ML
|
| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Oxaziclomefone
CAS:153197-14-9
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
|
| | OXAZICLOMEFONE Basic information |
| Product Name: | OXAZICLOMEFONE | | Synonyms: | 3-[1-(3,5-Dichlorophenyl)-1-methylethyl]-3,4-dihydro-6-methyl-5-phenyl-2H-1,3-oxazin-4-one;Oxaziclomefone Solution, 100ppm;OXAZICLOMEFONE;my-100;oxaziclomefone(bsi, pa iso);Oxaziclomefone [iso];3-(2-(3,5-dichlorophenyl)propan-2-yl)-6-methyl-5-phenyl-2H-1,3-oxazin-4(3H)-one;Oxaziclomefone@100 μg/mL in Methanol | | CAS: | 153197-14-9 | | MF: | C20H19Cl2NO2 | | MW: | 376.28 | | EINECS: | | | Product Categories: | | | Mol File: | 153197-14-9.mol |  |
| | OXAZICLOMEFONE Chemical Properties |
| Melting point | 147～151℃ | | Boiling point | 518.6±50.0 °C(Predicted) | | density | 1.277±0.06 g/cm3(Predicted) | | storage temp. | 0-6°C | | pka | -2.24±0.60(Predicted) | | Major Application | agriculture
environmental | | InChI | 1S/C20H19Cl2NO2/c1-13-18(14-7-5-4-6-8-14)19(24)23(12-25-13)20(2,3)15-9-16(21)11-17(22)10-15/h4-11H,12H2,1-3H3 | | InChIKey | FCOHEOSCARXMMS-UHFFFAOYSA-N | | SMILES | CC1=C(C(=O)N(CO1)C(C)(C)c2cc(Cl)cc(Cl)c2)c3ccccc3 |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 61 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | OXAZICLOMEFONE Usage And Synthesis |
| Uses | Oxaziclomefone is a novel oxazinone herbicide that inhibits cell expansion in maize cell cultures without affecting turgor pressure or wall acidification. Oxaziclomefone is also used for pre- and early post-emergence barnyard grass control in rice. | | Definition | ChEBI: Oxaziclomefone is an alkylbenzene. |
| | OXAZICLOMEFONE Preparation Products And Raw materials |
|