| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | ACETIC ANHYDRIDE (1,1',2,2'-13C4) Basic information | | Application |
| Product Name: | ACETIC ANHYDRIDE (1,1',2,2'-13C4) | | Synonyms: | ACETIC ANHYDRIDE (1,1',2,2'-13C4);ACETIC-13C2 ANHYDRIDE;ACETIC-13C2 ANHYDRIDE, 99 ATOM % 13C;Acetic-1,2-13C2 Acid 1,1'-Anhydride;D6, 98%);DIMETHYLAMINE:HCL (13C2, 99%;Acetic anhydride-13C?;Acetic anhydride-13C4 | | CAS: | 114510-14-4 | | MF: | C4H6O3 | | MW: | 106.12 | | EINECS: | | | Product Categories: | Alphabetical Listings;AStable Isotopes;Biomolecular MS;Chemical Labeling Products;Stable Isotopes | | Mol File: | 114510-14-4.mol |  |
| | ACETIC ANHYDRIDE (1,1',2,2'-13C4) Chemical Properties |
| Melting point | -73 °C (lit.) | | Boiling point | 138-140 °C (lit.) | | density | 1.122 g/mL at 25 °C | | refractive index | n20/D 1.39(lit.) | | Fp | 130 °F | | InChI | 1S/C4H6O3/c1-3(5)7-4(2)6/h1-2H3/i1+1,2+1,3+1,4+1 | | InChIKey | WFDIJRYMOXRFFG-JCDJMFQYSA-N | | SMILES | [13CH3][13C](=O)O[13C]([13CH3])=O | | CAS Number Unlabeled | 108-24-7 |
| Hazard Codes | C | | Risk Statements | 10-34-20/22 | | Safety Statements | 26-45-36/37/39 | | RIDADR | UN 1715 8/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 2 Inhalation
Acute Tox. 4 Oral
Eye Dam. 1
Flam. Liq. 3
Skin Corr. 1B |
| | ACETIC ANHYDRIDE (1,1',2,2'-13C4) Usage And Synthesis |
| Application | Acetic anhydride-13C4 is an isotope label for acetic anhydride, characterized by convenient detection and high sensitivity. It can be used to study acetic anhydride metabolism, its synthesis and breakdown in vivo; in medical experiments, it can also be used to track the sites of action and metabolism of acetic anhydride. An isotope is a chemically identical element with different masses. The method of replacing a specific atom in a molecule with its isotope is called isotope labeling. |
| | ACETIC ANHYDRIDE (1,1',2,2'-13C4) Preparation Products And Raw materials |
|