| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:3-Cyanophenylboronic acid MIDA ester CAS:1257738-14-9 Purity:97% Package:1G,5G
|
| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:3-Cyanophenylboronic Acid Mida Ester CAS:1257738-14-9 Purity:97% Package:100mg;250mg;1g;5g;25g
|
|
| | 3-(6-Methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzonitrile Basic information |
| | 3-(6-Methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzonitrile Chemical Properties |
| Melting point | 256-260 °C | | form | powder | | InChI | 1S/C12H11BN2O4/c1-15-7-11(16)18-13(19-12(17)8-15)10-4-2-3-9(5-10)6-14/h2-5H,7-8H2,1H3 | | InChIKey | RMNLMKOJDVKOHO-UHFFFAOYSA-N | | SMILES | CN1CC(=O)OB(OC(=O)C1)c2cccc(c2)C#N |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-(6-Methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzonitrile Usage And Synthesis |
| | 3-(6-Methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzonitrile Preparation Products And Raw materials |
|