| Company Name: |
TianJin Alta Scientific Co., Ltd.
|
| Tel: |
022-65378550-8551 |
| Email: |
contact@altascientific.com |
| Products Intro: |
Product Name:Bentazon-D7
CAS:131842-77-8
Purity:98% 1Mg 5Mg 10Mg
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Bentazon-d7
CAS:131842-77-8
Purity:99% Package:10mg;100mg;1g
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:3-Isopropyl-d7-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide
CAS:131842-77-8
Purity:CP：95%，atom：98% Package:1mg Remarks:B72860
|
| Company Name: |
Nanjing Haolv Biotechnology Co.,Ltd
|
| Tel: |
025-84622273 17361806303 |
| Email: |
kexin.zhou@haolvbiotech.com |
| Products Intro: |
Product Name:Bentazon-d7
CAS:131842-77-8
Purity:98%+ Package:5g;1g;500mg;100mg;25mg;10mg
|
|
| | 3-Isopropyl-d7-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide Basic information |
| | 3-Isopropyl-d7-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide Chemical Properties |
| Melting point | >100°C (dec.) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White to Light Brown | | Major Application | agriculture
environmental | | InChI | 1S/C10H12N2O3S/c1-7(2)12-10(13)8-5-3-4-6-9(8)11-16(12,14)15/h3-7,11H,1-2H3/i1D3,2D3,7D | | InChIKey | ZOMSMJKLGFBRBS-QXMYYZBZSA-N | | SMILES | [2H]C([2H])([2H])C([2H])(N1C(=O)c2ccccc2NS1(=O)=O)C([2H])([2H])[2H] |
| Hazard Codes | Xn | | Risk Statements | 22-36-52/53-43 | | Safety Statements | 24-37-61 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Eye Irrit. 2
Skin Sens. 1 |
| | 3-Isopropyl-d7-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide Usage And Synthesis |
| Uses | Bentazon-d7 is deuterium labelled Bentazon (B120580), which is a herbicide. |
| | 3-Isopropyl-d7-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide Preparation Products And Raw materials |
|