| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | trans-2-Phenylvinylboronic acid MIDA ester Basic information |
| Product Name: | trans-2-Phenylvinylboronic acid MIDA ester | | Synonyms: | trans-2-Phenylvinylboronic acid MIDA ester;trans-2-Phenylvinylboronic acid MIDA ester 95%;Boron, [N-[(carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO][(1E)-2-phenylethenyl]-, (T-4)-;4-methyl-8-styryldihydro-4l4,8l4-[1,3,2]oxazaborolo[2,3-b][1,3,2]oxazaborole-2,6(3H,5H)-dione;trans-2-Phenylvinylboronic acid MIDA ester | | CAS: | 1152427-93-4 | | MF: | C13H14BNO4 | | MW: | 259.07 | | EINECS: | | | Product Categories: | Alkenyl;Boronic Acids and Derivatives;MIDA Boronates | | Mol File: | 1152427-93-4.mol |  |
| | trans-2-Phenylvinylboronic acid MIDA ester Chemical Properties |
| Melting point | 185-195 °C | | form | powder | | InChI | 1S/C13H14BNO4/c1-15-9-12(16)18-14(19-13(17)10-15)8-7-11-5-3-2-4-6-11/h2-8H,9-10H2,1H3/b8-7+ | | InChIKey | OFLDLTAQNBBGGU-BQYQJAHWSA-N | | SMILES | CN1CC(=O)OB(OC(=O)C1)\C=C\c2ccccc2 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | trans-2-Phenylvinylboronic acid MIDA ester Usage And Synthesis |
| Uses | trans-2-Phenylvinylboronic acid MIDA ester is a stable boronic acid surrogate, which can be used as a reactant in Suzuki-Miyaura cross-coupling reactions . It is also used as a precursor to prepare α-borylated phenyl ketone via the Wacker-type oxidation method. |
| | trans-2-Phenylvinylboronic acid MIDA ester Preparation Products And Raw materials |
|