3-Iodobenzaldehyde[4-(diphenylamino)-6-(4-morpholinyl)-1,3,5-triazin-2-yl]hydrazone manufacturers
- Vacuolin-1
-
- $31.00
-
2026-07-27
- CAS:351986-85-1
- Purity: 99.45%
- Supply Ability: 10g
|
| | 3-Iodobenzaldehyde[4-(diphenylamino)-6-(4-morpholinyl)-1,3,5-triazin-2-yl]hydrazone Basic information |
| Product Name: | 3-Iodobenzaldehyde[4-(diphenylamino)-6-(4-morpholinyl)-1,3,5-triazin-2-yl]hydrazone | | Synonyms: | 4-[(2E)-2-(3-iodobenzylidene)hydrazinyl]-6-(morpholin-4-yl)-N,N-diphenyl-1,3,5-triazin-2-amine;3-Iodobenzaldehyde[4-(diphenylamino)-6-(4-morpholinyl)-1,3,5-triazin-2-yl]hydrazone;Vacuolin-1;(E)-4-(2-(3-iodobenzylidene)hydrazinyl)-6-Morpholino-N,N-diphenyl-1,3,5-triazin-2-aMine;Vacuolin-1 - CAS 351986-85-1 - Calbiochem;Benzaldehyde, 3-iodo-, 2-[4-(diphenylamino)-6-(4-morpholinyl)-1,3,5-triazin-2-yl]hydrazone;4-(2-(3-Iodobenzylidene)hydrazinyl)-6-morpholino-N,N-diphenyl-1,3,5-triazin-2-amine;Inhibitor,Fab1,Vacuolin1,Autophagy,Vacuolin 1,PIKfyve,membrane repair,Vacuolin-1,inhibit,exocytosis,HeLa cells | | CAS: | 351986-85-1 | | MF: | C26H24IN7O | | MW: | 577.42 | | EINECS: | | | Product Categories: | | | Mol File: | 351986-85-1.mol | ![3-Iodobenzaldehyde[4-(diphenylamino)-6-(4-morpholinyl)-1,3,5-triazin-2-yl]hydrazone Structure](CAS/GIF/351986-85-1.gif) |
| | 3-Iodobenzaldehyde[4-(diphenylamino)-6-(4-morpholinyl)-1,3,5-triazin-2-yl]hydrazone Chemical Properties |
| Melting point | 187.3-188.5 °C | | Boiling point | 719.7±70.0 °C(Predicted) | | density | 1.53±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO:18.33(Max Conc. mg/mL);31.74(Max Conc. mM)
DMSO:PBS (pH 7.2) (1:7):0.12(Max Conc. mg/mL);0.21(Max Conc. mM)
DMF:3.0(Max Conc. mg/mL);5.2(Max Conc. mM) | | form | White solid | | pka | 10.74±0.10(Predicted) | | color | White to off-white | | Appearance | white powder | | InChIKey | JMEJTSRAQUFNOP-TURZUDJPSA-N | | SMILES | Ic1cc(ccc1)\C=N\Nc2nc(nc(n2)N(c5ccccc5)c4ccccc4)N3CCOCC3 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3-Iodobenzaldehyde[4-(diphenylamino)-6-(4-morpholinyl)-1,3,5-triazin-2-yl]hydrazone Usage And Synthesis |
| Description | Vacuolin-1 is a triazine-based small chemical, a specific inhibitor of Ca2+–dependent lysosomal exocytosis. The inhibitor penetrates the cell, blocking the fusion of lysosomes with the plasma membrane. Vacuolin-1 does not affect other membrane-bound organelles and endocytic or secretory traffic. The inhibitor is widely used in studies on the release of lysosomal content and the modulation of autophagy. | | Uses | Vacuolin-1 is a cell-permeable triazine that inhibits Ca2+-dependent fusion of lysosomes to the cell membrane inhibiting release of lysosomal content. | | Biological Activity | Cell permeable: yes', 'Primary Target
Ca2+-dependent fusion of lysosomes with the plasma membrane', 'Product does not compete with ATP.', 'Reversible: no |
| | 3-Iodobenzaldehyde[4-(diphenylamino)-6-(4-morpholinyl)-1,3,5-triazin-2-yl]hydrazone Preparation Products And Raw materials |
|