| Company Name: |
Sci General Material & Chemical Ltd
|
| Tel: |
021-58388037;21-58388037 13472507714 |
| Email: |
35177634@qq.com;1589045147@qq.com |
| Products Intro: |
Product Name:(R)-2-[Bis(3,5-diMethylphenyl)Methyl]pyrrolidine >=98.0% (HPLC) CAS:948595-04-8
|
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
| Products Intro: |
Product Name:(R)-2-[Bis(3,5-dimethylphenyl)methyl]pyrrolidine CAS:948595-04-8 Purity:98% Package:按需包装
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(R)-2-[Bis(3,5-dimethylphenyl)methyl]pyrrolidine CAS:948595-04-8 Purity:>=98.0% (HPLC) Package:500MG Remarks:670405-500MG
|
| Company Name: |
Shanghai Chiral bio-compound co., Ltd.
|
| Tel: |
021-5068 3667/17749785980/1029026415; 17749785980 |
| Email: |
1029026415@qq.com |
| Products Intro: |
Product Name:(R)-2-[Bis(3,5-diMethylphenyl)Methyl]pyrrolidine CAS:948595-04-8 Purity:97% Package:100mg,1g,100g,1kg
|
|
| | (R)-2-[Bis(3,5-dimethylphenyl)methyl]pyrrolidine Basic information |
| Product Name: | (R)-2-[Bis(3,5-dimethylphenyl)methyl]pyrrolidine | | Synonyms: | (R)-2-[Bis(3,5-dimethylphenyl)methyl]pyrrolidine;(R)-2-[Bis(3,5-diMethylphenyl)Methyl]pyrrolidine >=98.0% (HPLC);(2R)-2-[bis(3,5-dimethylphenyl)methyl]pyrrolidine;Pyrrolidine, 2-[bis(3,5-dimethylphenyl)methyl]-, (2R)-;(R)-2-[Bis(3,5-dimethylphenyl)methyl]pyrrolidine | | CAS: | 948595-04-8 | | MF: | C21H27N | | MW: | 293.45 | | EINECS: | | | Product Categories: | Asymmetric Synthesis;Chiral Catalysts, Ligands, and Reagents;CycloadditionAsymmetric Synthesis;Proline-Based Organocatalysts | | Mol File: | 948595-04-8.mol | ![(R)-2-[Bis(3,5-dimethylphenyl)methyl]pyrrolidine Structure](CAS/GIF/948595-04-8.gif) |
| | (R)-2-[Bis(3,5-dimethylphenyl)methyl]pyrrolidine Chemical Properties |
| Melting point | 97-101 °C | | storage temp. | 2-8°C | | InChI | 1S/C21H27N/c1-14-8-15(2)11-18(10-14)21(20-6-5-7-22-20)19-12-16(3)9-17(4)13-19/h8-13,20-22H,5-7H2,1-4H3/t20-/m1/s1 | | InChIKey | PHKHWUVAUXBNPC-HXUWFJFHSA-N | | SMILES | Cc1cc(C)cc(c1)C([C@H]2CCCN2)c3cc(C)cc(C)c3 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | (R)-2-[Bis(3,5-dimethylphenyl)methyl]pyrrolidine Usage And Synthesis |
| | (R)-2-[Bis(3,5-dimethylphenyl)methyl]pyrrolidine Preparation Products And Raw materials |
|