|
|
| | 3-Phenyl-5-piperazino-1,2,4-thiadiazole Basic information |
| Product Name: | 3-Phenyl-5-piperazino-1,2,4-thiadiazole | | Synonyms: | 3-Phenyl-5-piperazino-1,2,4-thiadiazole 97%;3-Phenyl-5-piperazin-1-yl-1,2,4-thiadiazole;3-Phenyl-5-piperazin-1-yl-1,2,4-thiadiazole 97%;1-(3-Phenyl-1,2,4-thiadiazol-5-yl)piperazine 97%;1-(3-Phenyl-1,2,4-thiadiazol-5-yl)piperazine97%;Piperazine, 1-(3-phenyl-1,2,4-thiadiazol-5-yl)-;3-Phenyl-5-piperazino-1,2,4-thiadiazole | | CAS: | 306935-14-8 | | MF: | C12H14N4S | | MW: | 246.33 | | EINECS: | | | Product Categories: | | | Mol File: | 306935-14-8.mol |  |
| | 3-Phenyl-5-piperazino-1,2,4-thiadiazole Chemical Properties |
| Melting point | 91-93 | | Boiling point | 415.9±55.0 °C(Predicted) | | density | 1.238±0.06 g/cm3(Predicted) | | pka | 8.27±0.10(Predicted) | | form | solid | | InChI | 1S/C12H14N4S/c1-2-4-10(5-3-1)11-14-12(17-15-11)16-8-6-13-7-9-16/h1-5,13H,6-9H2 | | InChIKey | UMFMHSLRNJBGKO-UHFFFAOYSA-N | | SMILES | C1CN(CCN1)c2nc(ns2)-c3ccccc3 |
| Hazard Codes | C,T | | Risk Statements | 36/37/38-25 | | Safety Statements | 26-36/37/39-45 | | WGK Germany | WGK 3 | | Hazard Note | Corrosive | | HazardClass | IRRITANT | | HS Code | 2933599590 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-Phenyl-5-piperazino-1,2,4-thiadiazole Usage And Synthesis |
| | 3-Phenyl-5-piperazino-1,2,4-thiadiazole Preparation Products And Raw materials |
|