| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Trimethylsilyl(trimethylsiloxy)acetate Basic information |
| | Trimethylsilyl(trimethylsiloxy)acetate Chemical Properties |
| Boiling point | 82-83 °C15 mm Hg | | density | 0.903 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.411(lit.) | | Fp | 110 °F | | storage temp. | Inert atmosphere,Room Temperature | | Specific Gravity | 0.918 | | Appearance | Colorless to light yellow Liquid | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 2045011 | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | 1S/C8H20O3Si2/c1-12(2,3)10-7-8(9)11-13(4,5)6/h7H2,1-6H3 | | InChIKey | MAEQOWMWOCEXKP-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)OCC(=O)O[Si](C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 2 | | F | 21 | | TSCA | No | | HazardClass | 3.2 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | Trimethylsilyl(trimethylsiloxy)acetate Usage And Synthesis |
| Uses | Trimethylsilyl trimethylsiloxyacetate has been used in the synthesis of zirconium(IV) carboxylato complexes [LOEtZr(OCOCH2OH)(O2CCH2O)]2. |
| | Trimethylsilyl(trimethylsiloxy)acetate Preparation Products And Raw materials |
|