|
|
| | 4-(4-Chlorophenyl)cyclohexanecarboxylic acid Basic information |
| Product Name: | 4-(4-Chlorophenyl)cyclohexanecarboxylic acid | | Synonyms: | TRANS-4-(4-CHLOROPHENYL)CYCLOHEXANECARBOXYLIC;TRANS-4-(4-CHLOROPHENYL)CYCLOHEXANECARBOXYLIC ACID;4-(4-CHLOROPHENYL)CYCLOHENXANECARBOXYLICACID;4-(p-Chlorophenyl)-1-cyclohexanecarboxylic acid;4-(4-Chlorophenyl)cyclohexanecarboxylic acid;4-(CHLOROPHENYL) CYCLOHEXANE-1-CARBOXYLIC ACID;1-Chloro-4-(trans-4-carboxycyclohex-1-yl)benzene, trans-1-Carboxy-4-(4-chlorophenyl)cyclohexane;4-(4-Chlorophenyl)cyclohexanecarboxylic | | CAS: | 49708-81-8 | | MF: | C13H15ClO2 | | MW: | 238.71 | | EINECS: | 212-512-3 | | Product Categories: | | | Mol File: | 49708-81-8.mol |  |
| | 4-(4-Chlorophenyl)cyclohexanecarboxylic acid Chemical Properties |
| Melting point | 252-254 °C | | Boiling point | 387.1±42.0 °C(Predicted) | | density | 1.225±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly, Sonicated), DMSO (Slightly), Methanol (Slightly, Sonicated) | | form | Solid | | pka | 4.80±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C13H15ClO2/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)16/h5-9,11H,1-4H2,(H,15,16)/t9-,11- | | InChIKey | NXXDIEYTMQYWJU-HOMQSWHASA-N | | SMILES | [C@@H]1(C(O)=O)CC[C@@H](C2=CC=C(Cl)C=C2)CC1 |
| | 4-(4-Chlorophenyl)cyclohexanecarboxylic acid Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | trans-4-(4-Chlorophenyl)cyclohexanecarboxylic Acid is an impurity of Atovaquone (A793500), which is a hydroxynaphthoquinone derivative that inhibits mitochondrial electron transport and possess antipneumocystic activity. |
| | 4-(4-Chlorophenyl)cyclohexanecarboxylic acid Preparation Products And Raw materials |
|