| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-(4-Chlorophenyl)-1-cyclohexanecarboxylic acid Basic information |
| Product Name: | 1-(4-Chlorophenyl)-1-cyclohexanecarboxylic acid | | Synonyms: | Cyclohexanecarboxylic acid, 1-(4-chlorophenyl)-;RARECHEM AL BO 1153;TIMTEC-BB SBB003226;LABOTEST-BB LT00455213;1-(4-CHLOROPHENYL)-1-CYCLOHEXANE-CARBOXYLIC ACID 95%;1-(4-Chlorophenyl)-1-cyclohexanecarboxylic acid,95%;1-(4-chlorophenyl)-1-cyclohexanecarboxylate;orophenyl)cyclohexanecarboxylic acid | | CAS: | 58880-37-8 | | MF: | C13H15ClO2 | | MW: | 238.71 | | EINECS: | 261-481-2 | | Product Categories: | | | Mol File: | 58880-37-8.mol |  |
| | 1-(4-Chlorophenyl)-1-cyclohexanecarboxylic acid Chemical Properties |
| Melting point | 150-156 °C | | Boiling point | 340.55°C (rough estimate) | | density | 1.1239 (rough estimate) | | refractive index | 1.5380 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Powder and Granules | | pka | 4.34±0.20(Predicted) | | color | Light gray | | BRN | 3297868 | | InChI | InChI=1S/C13H15ClO2/c14-11-6-4-10(5-7-11)13(12(15)16)8-2-1-3-9-13/h4-7H,1-3,8-9H2,(H,15,16) | | InChIKey | UPNXUJXIIZGXLQ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(Cl)C=C2)(C(O)=O)CCCCC1 | | CAS DataBase Reference | 58880-37-8(CAS DataBase Reference) |
| | 1-(4-Chlorophenyl)-1-cyclohexanecarboxylic acid Usage And Synthesis |
| Chemical Properties | LIGHT GREY POWDER AND GRANULES |
| | 1-(4-Chlorophenyl)-1-cyclohexanecarboxylic acid Preparation Products And Raw materials |
|