| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:4-tert-Octylphenol Diethoxylate CAS:2315-61-9 Package:100Mg,10Mg
|
|
| | 5-[4-(tert-Octyl)phenoxy]-3-oxapentane-1-ol Basic information |
| | 5-[4-(tert-Octyl)phenoxy]-3-oxapentane-1-ol Chemical Properties |
| Melting point | 132 °C | | Boiling point | 402.6±35.0 °C(Predicted) | | density | 0.982±0.06 g/cm3(Predicted) | | Fp | -17℃ | | storage temp. | -20°C | | solubility | Ethanol: Soluble | | form | Oil to Low-Melting Solid | | pka | 14.36±0.10(Predicted) | | color | Colourless to Off-White | | Major Application | environmental | | InChI | 1S/C18H30O3/c1-17(2,3)14-18(4,5)15-6-8-16(9-7-15)21-13-12-20-11-10-19/h6-9,19H,10-14H2,1-5H3 | | InChIKey | LBCZOTMMGHGTPH-UHFFFAOYSA-N | | SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOCCO)cc1 | | EPA Substance Registry System | 2-[2-[4-(1,1,3,3-Tetramethylbutyl)phenoxy]ethoxy]ethanol (2315-61-9) |
| Hazard Codes | F,Xi | | Risk Statements | 11-36-52/53-66-67 | | Safety Statements | 16-26-61-9 | | RIDADR | UN1090 - class 3 - PG 2 - Acetone, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Chronic 3 Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |
| | 5-[4-(tert-Octyl)phenoxy]-3-oxapentane-1-ol Usage And Synthesis |
| Chemical Properties | 2-[2-[4-(1,1,3,3-tetraMethylbutyl)phenoxy]ethoxy]-Ethanol is Colourless Oil | | Uses | 2-[2-[4-(1,1,3,3-tetraMethylbutyl)phenoxy]ethoxy]-Ethanol is a common enironmental pollutant showing weak estrogenic effects. Has been shown to cause harm to the male reproductive system of vertebrates in particular among aquatic species where gonadal intersex , altered sex ratios, and reduced gonad size has been observed. |
| | 5-[4-(tert-Octyl)phenoxy]-3-oxapentane-1-ol Preparation Products And Raw materials |
|