| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2-Bromo-4-nitrophenol manufacturers
|
| | 2-Bromo-4-nitrophenol Basic information |
| | 2-Bromo-4-nitrophenol Chemical Properties |
| Melting point | 118-119 °C | | Boiling point | 279℃ | | density | 1.881 | | Fp | 123℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | pka | 6.65±0.19(Predicted) | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C6H4BrNO3/c7-5-2-1-4(8(10)11)3-6(5)9/h1-3,9H | | InChIKey | KNJNITQHVLIWBN-UHFFFAOYSA-N | | SMILES | C1(O)=CC([N+]([O-])=O)=CC=C1Br |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HazardClass | 9 | | HS Code | 2907199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| | 2-Bromo-4-nitrophenol Usage And Synthesis |
| | 2-Bromo-4-nitrophenol Preparation Products And Raw materials |
|