| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Dibenzyl N,N-dimethylphosphoramidite manufacturers
|
| | Dibenzyl N,N-dimethylphosphoramidite Basic information |
| | Dibenzyl N,N-dimethylphosphoramidite Chemical Properties |
| Boiling point | 328.2±31.0 °C(Predicted) | | density | 1.089 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.553 | | storage temp. | 2-8°C | | pka | 3.52±0.70(Predicted) | | BRN | 7427974 | | InChI | 1S/C16H20NO2P/c1-17(2)20(18-13-15-9-5-3-6-10-15)19-14-16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3 | | InChIKey | GDEJGFHRPXLQNN-UHFFFAOYSA-N | | SMILES | CN(C)P(OCc1ccccc1)OCc2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 1-10 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Dibenzyl N,N-dimethylphosphoramidite Usage And Synthesis |
| Uses | Dibenzyl N,N-dimethylphosphoramidite is used as a synthetic reagent in the enzyme-assisted synthesis of inositol triphosphate. |
| | Dibenzyl N,N-dimethylphosphoramidite Preparation Products And Raw materials |
|