| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5'-Nucleotide phosphodiesterase substrate Basic information |
| | 5'-Nucleotide phosphodiesterase substrate Chemical Properties |
| Boiling point | 465.4±47.0 °C(Predicted) | | density | 1.45±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 30 mg/mL; DMF:PBS(pH 7.2)(1:1): 0.5 mg/mL; DMSO: 14 mg/mL | | form | A crystalline solid | | pka | 1.86±0.58(Predicted) | | InChI | 1S/C12H10NO5P/c14-13(15)10-6-8-11(9-7-10)18-19(16,17)12-4-2-1-3-5-12/h1-9H,(H,16,17) | | InChIKey | NRGZTHQFAQCJCQ-UHFFFAOYSA-N | | SMILES | OP(=O)(Oc1ccc(cc1)N(=O)=O)c2ccccc2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 5'-Nucleotide phosphodiesterase substrate Usage And Synthesis |
| Uses | 4-Nitrophenyl phenylphosphonate is a substrate for 5'-nucleotide phosphodiesterase[1]. | | References | [1] Kelly SJ, et al. Hydrolysis of phosphonate esters catalyzed by 5'-nucleotide phosphodiesterase. Biochemistry. 1975 Nov 4;14(22):4983-8. DOI:10.1021/bi00693a030 |
| | 5'-Nucleotide phosphodiesterase substrate Preparation Products And Raw materials |
|