2,2,6-Trimethyl-2,6-dihydro-5H-pyrano[3,2-c]quinoline-5-one manufacturers
|
| | 2,2,6-Trimethyl-2,6-dihydro-5H-pyrano[3,2-c]quinoline-5-one Basic information |
| Product Name: | 2,2,6-Trimethyl-2,6-dihydro-5H-pyrano[3,2-c]quinoline-5-one | | Synonyms: | 2,2,6-Trimethyl-2,6-dihydro-5H-pyrano[3,2-c]quinoline-5-one;2,2,6-Trimethyl-2H-pyrano[3,2-c]quinolin-5(6H)-one;NSC 347659;5H-Pyrano[3,2-c]quinolin-5-one, 2,6-dihydro-2,2,6-trimethyl-;2,2,6-trimethylpyrano[3,2-c]quinolin-5-one;2,2,6-Trimethyl-2H,5H-pyrano[3,2-c]quinolin-5-one;N-Methylflindersine,NMethylflindersine,Inhibitor,inhibit,N Methylflindersine;N-Methylflindersine, 10 mM in DMSO | | CAS: | 50333-13-6 | | MF: | C15H15NO2 | | MW: | 241.29 | | EINECS: | | | Product Categories: | | | Mol File: | 50333-13-6.mol | ![2,2,6-Trimethyl-2,6-dihydro-5H-pyrano[3,2-c]quinoline-5-one Structure](CAS/GIF/50333-13-6.gif) |
| | 2,2,6-Trimethyl-2,6-dihydro-5H-pyrano[3,2-c]quinoline-5-one Chemical Properties |
| Melting point | 85℃ | | Boiling point | 365.8±42.0 °C(Predicted) | | density | 1.22±0.1 g/cm3(Predicted) | | pka | 0.40±0.40(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C15H15NO2/c1-15(2)9-8-11-13(18-15)10-6-4-5-7-12(10)16(3)14(11)17/h4-9H,1-3H3 | | InChIKey | RJZFGBNKPOVCHQ-UHFFFAOYSA-N | | SMILES | N1(C)C2=C(C=CC=C2)C2OC(C)(C)C=CC=2C1=O |
| | 2,2,6-Trimethyl-2,6-dihydro-5H-pyrano[3,2-c]quinoline-5-one Usage And Synthesis |
| Uses | N-Methylflindersine is a compound isolated as insect antifeedants from the East African Rutaceous medicinal plants Fagara chalybea and F. holtziana[1]. | | Definition | ChEBI: N-Methylflindersine is an oxacycle, an organic heterotricyclic compound and an organonitrogen heterocyclic compound. | | References | [1] Makoto TANIGUCHI, et al. Biocidal Alkaloids from African Fagara Plants: Inhibition of Mitochondrial Function. |
| | 2,2,6-Trimethyl-2,6-dihydro-5H-pyrano[3,2-c]quinoline-5-one Preparation Products And Raw materials |
|