| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Fluorosulfuric acid 4-methoxyphenyl ester Basic information |
| Product Name: | Fluorosulfuric acid 4-methoxyphenyl ester | | Synonyms: | Fluorosulfuric acid 4-methoxyphenyl ester;4-Methoxyphenyl ester fluorosulfuric acid;4-Methoxyphenyl sulfofluoridate;4-methoxyphenyl sulfurofluoridate;4-Methoxyphenyl fluorosulfate | | CAS: | 775-27-9 | | MF: | C7H7FO4S | | MW: | 206.19 | | EINECS: | | | Product Categories: | | | Mol File: | 775-27-9.mol |  |
| | Fluorosulfuric acid 4-methoxyphenyl ester Chemical Properties |
| density | 1.367 g/mL at 25 °C | | refractive index | n20/D 1.479 | | form | liquid | | InChI | 1S/C7H7FO4S/c1-11-6-2-4-7(5-3-6)12-13(8,9)10/h2-5H,1H3 | | InChIKey | KRFXUAVCNYFMJE-UHFFFAOYSA-N | | SMILES | O=S(OC1=CC=C(OC)C=C1)(F)=O |
| WGK Germany | WGK 3 | | Storage Class | 8B - Non-combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Fluorosulfuric acid 4-methoxyphenyl ester Usage And Synthesis |
| Uses | The following aryl fluorosulfate can be utilized as a cross-coupling partner in Suzuki-Miyaura reactions. The standard reaction conditions for these palladium-catalyzed C-C bond formations are ligand-free and can be performed in water, at room temperature and are not air sensitive. |
| | Fluorosulfuric acid 4-methoxyphenyl ester Preparation Products And Raw materials |
|