|
|
| | 4-(Chloromethyl)-5-methyl-2-(3-methylphenyl)-1,3-oxazole Basic information |
| Product Name: | 4-(Chloromethyl)-5-methyl-2-(3-methylphenyl)-1,3-oxazole | | Synonyms: | 4-(CHLOROMETHYL)-5-METHYL-2-M-TOLYLOXAZOLE;4-(chloromethyl)-5-methyl-2-(3-methylphenyl)-1,3-oxazole(SALTDATA: FREE);4-(chloromethyl)-5-methyl-2-(3-methylphenyl)oxazole;EU-0062800;Oxazole, 4-(chloromethyl)-5-methyl-2-(3-methylphenyl)-;4-(Chloromethyl)-5-methyl-2-(3-methylphenyl)-1,3-oxazole | | CAS: | 521266-92-2 | | MF: | C12H12ClNO | | MW: | 221.68 | | EINECS: | | | Product Categories: | | | Mol File: | 521266-92-2.mol |  |
| | 4-(Chloromethyl)-5-methyl-2-(3-methylphenyl)-1,3-oxazole Chemical Properties |
| Boiling point | 362.0±44.0 °C(Predicted) | | density | 1.160±0.06 g/cm3(Predicted) | | pka | -0.12±0.26(Predicted) | | form | solid | | InChI | 1S/C12H12ClNO/c1-8-4-3-5-10(6-8)12-14-11(7-13)9(2)15-12/h3-6H,7H2,1-2H3 | | InChIKey | CZFJTOSWONKWDN-UHFFFAOYSA-N | | SMILES | ClCC(N=C(C1=CC=CC(C)=C1)O2)=C2C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-(Chloromethyl)-5-methyl-2-(3-methylphenyl)-1,3-oxazole Usage And Synthesis |
| | 4-(Chloromethyl)-5-methyl-2-(3-methylphenyl)-1,3-oxazole Preparation Products And Raw materials |
|