|
|
| | 5-Chloropyrimidine-2-carbaldehyde Basic information |
| | 5-Chloropyrimidine-2-carbaldehyde Chemical Properties |
| Boiling point | 307.6±34.0 °C(Predicted) | | density | 1.432±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -2.52±0.22(Predicted) | | InChI | InChI=1S/C5H3ClN2O/c6-4-1-7-5(3-9)8-2-4/h1-3H | | InChIKey | ACZIIAYMCSXFNQ-UHFFFAOYSA-N | | SMILES | C1(C=O)=NC=C(Cl)C=N1 |
| | 5-Chloropyrimidine-2-carbaldehyde Usage And Synthesis |
| Uses |
5-CHLOROPYRIMIDINE-2-CARBALDEHYDE is a heterocyclic structural unit with good reactivity, used as a pharmaceutical intermediate. This compound possesses two functional groups—a halogenated chlorine group and a formyl group (-CHO)—and can be employed in transformation reactions such as substitution, condensation, cyanation and sulphurisation.
|
| | 5-Chloropyrimidine-2-carbaldehyde Preparation Products And Raw materials |
|