|
|
| | 5-Chloro-2-methyl-benzoic acid methyl ester Basic information |
| Product Name: | 5-Chloro-2-methyl-benzoic acid methyl ester | | Synonyms: | methyl 2-methyl-5-chlorobenzoate;Benzoic acid, 5-chloro-2-methyl-, methyl ester;5-CHLORO-2-METHYL-BENZOIC ACID METHYL ESTER ISO 9001:2015 REACH;Methyl 5-chloro-2-metthylbenzoate;Benzoylchloride,6-(dimethylamino)-;Methyl 5-Chloro-2-Methylbenzoate;5-Chloro-2-methyl-benzoic acid methyl ester | | CAS: | 99585-13-4 | | MF: | C9H9ClO2 | | MW: | 184.62 | | EINECS: | | | Product Categories: | | | Mol File: | 99585-13-4.mol |  |
| | 5-Chloro-2-methyl-benzoic acid methyl ester Chemical Properties |
| Boiling point | 245.6±20.0 °C(Predicted) | | density | 1.186±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C9H9ClO2/c1-6-3-4-7(10)5-8(6)9(11)12-2/h3-5H,1-2H3 | | InChIKey | HMGNABFNVYLVMD-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(Cl)=CC=C1C |
| | 5-Chloro-2-methyl-benzoic acid methyl ester Usage And Synthesis |
| | 5-Chloro-2-methyl-benzoic acid methyl ester Preparation Products And Raw materials |
|