|
|
| | N-Boc-3-amino-5-methoxypyridine Basic information |
| Product Name: | N-Boc-3-amino-5-methoxypyridine | | Synonyms: | tert-butyl N-(5-Methoxypyridin-3-yl)carbaMate;(5-Methoxy-pyridin-3-yl)-carbamic acid tert-butyl ester;3-Boc-aMino-5-Methoxypyridine;Carbamic acid, N-(5-methoxy-3-pyridinyl)-, 1,1-dimethylethyl ester;N-Boc-5-methoxypyridin-3-amine;1,1-Dimethylethyl N-(5-methoxy-3-pyridinyl)carbamate;N-Boc-3-amino-5-methoxypyridine | | CAS: | 342603-10-5 | | MF: | C11H16N2O3 | | MW: | 224.26 | | EINECS: | | | Product Categories: | | | Mol File: | 342603-10-5.mol |  |
| | N-Boc-3-amino-5-methoxypyridine Chemical Properties |
| storage temp. | Store at room temperature | | form | solid | | Appearance | Light yellow to light brown Solid | | InChI | 1S/C11H16N2O3/c1-11(2,3)16-10(14)13-8-5-9(15-4)7-12-6-8/h5-7H,1-4H3,(H,13,14) | | InChIKey | FUSHCJZMKFNATD-UHFFFAOYSA-N | | SMILES | COc1cncc(NC(=O)OC(C)(C)C)c1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | N-Boc-3-amino-5-methoxypyridine Usage And Synthesis |
| | N-Boc-3-amino-5-methoxypyridine Preparation Products And Raw materials |
|